About (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine
(2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine (PubChem CID 84772456) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine.
Molecular Properties
| Compound Name | (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine |
| PubChem CID | 84772456 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine |
| SMILES | NCc1c(C2CCC2)oc2c1CNC2 |
| InChI | InChI=1S/C11H16N2O/c12-4-8-9-5-13-6-10(9)14-11(8)7-2-1-3-7/h7,13H,1-6,12H2 |
| InChIKey | XYJSGIYYCTUXHM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine?
The IUPAC name of (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine (CID 84772456) is (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine.
What is the SMILES notation for (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine?
The canonical SMILES for (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine is NCc1c(C2CCC2)oc2c1CNC2.
What is the InChIKey of (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine?
The InChIKey is XYJSGIYYCTUXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c12-4-8-9-5-13-6-10(9)14-11(8)7-2-1-3-7/h7,13H,1-6,12H2.
What are the key properties of (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine?
(2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine has a molecular weight of 192.26 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclobutyl-5,6-dihydro-4H-furo[2,3-c]pyrrol-3-yl)methanamine is sourced from PubChem (CID 84772456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).