C12H16FN — CID 84772855
3-(3-fluoro-2,5-dimethylphenyl)pyrrolidine (PubChem CID 84772855) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 3-(3-fluoro-2,5-dimethylphenyl)pyrrolidine.
| Compound Name | 3-(3-fluoro-2,5-dimethylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 84772855 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-(3-fluoro-2,5-dimethylphenyl)pyrrolidine |
| SMILES | Cc1cc(F)c(C)c(C2CCNC2)c1 |
| InChI | InChI=1S/C12H16FN/c1-8-5-11(9(2)12(13)6-8)10-3-4-14-7-10/h5-6,10,14H,3-4,7H2,1-2H3 |
| InChIKey | DFMGHNVNWULNDT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |