About 3-(2-chloro-3,6-dimethylphenyl)propanenitrile
3-(2-chloro-3,6-dimethylphenyl)propanenitrile (PubChem CID 84773025) has the molecular formula C11H12ClN
and a molecular weight of 193.68 g/mol. Its IUPAC name is 3-(2-chloro-3,6-dimethylphenyl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2-chloro-3,6-dimethylphenyl)propanenitrile |
| PubChem CID | 84773025 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(2-chloro-3,6-dimethylphenyl)propanenitrile |
| SMILES | Cc1ccc(C)c(CCC#N)c1Cl |
| InChI | InChI=1S/C11H12ClN/c1-8-5-6-9(2)11(12)10(8)4-3-7-13/h5-6H,3-4H2,1-2H3 |
| InChIKey | VPOKPPZRRQWCTB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-chloro-3,6-dimethylphenyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-3,6-dimethylphenyl)propanenitrile?
The IUPAC name of 3-(2-chloro-3,6-dimethylphenyl)propanenitrile (CID 84773025) is 3-(2-chloro-3,6-dimethylphenyl)propanenitrile.
What is the SMILES notation for 3-(2-chloro-3,6-dimethylphenyl)propanenitrile?
The canonical SMILES for 3-(2-chloro-3,6-dimethylphenyl)propanenitrile is Cc1ccc(C)c(CCC#N)c1Cl.
What is the InChIKey of 3-(2-chloro-3,6-dimethylphenyl)propanenitrile?
The InChIKey is VPOKPPZRRQWCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN/c1-8-5-6-9(2)11(12)10(8)4-3-7-13/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-(2-chloro-3,6-dimethylphenyl)propanenitrile?
3-(2-chloro-3,6-dimethylphenyl)propanenitrile has a molecular weight of 193.68 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-3,6-dimethylphenyl)propanenitrile is sourced from PubChem (CID 84773025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).