C10H10FNO2 — CID 84773304
1-(5-fluoro-1,3-benzodioxol-4-yl)cyclopropan-1-amine (PubChem CID 84773304) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 1-(5-fluoro-1,3-benzodioxol-4-yl)cyclopropan-1-amine.
| Compound Name | 1-(5-fluoro-1,3-benzodioxol-4-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84773304 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 1-(5-fluoro-1,3-benzodioxol-4-yl)cyclopropan-1-amine |
| SMILES | NC1(c2c(F)ccc3c2OCO3)CC1 |
| InChI | InChI=1S/C10H10FNO2/c11-6-1-2-7-9(14-5-13-7)8(6)10(12)3-4-10/h1-2H,3-5,12H2 |
| InChIKey | NDGCFJKAXVRZFM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |