About 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine
1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine (PubChem CID 84773729) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine |
| PubChem CID | 84773729 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine |
| SMILES | NC1(c2cc3c(s2)CCOC3)CC1 |
| InChI | InChI=1S/C10H13NOS/c11-10(2-3-10)9-5-7-6-12-4-1-8(7)13-9/h5H,1-4,6,11H2 |
| InChIKey | MHCKIRLSRZLXBJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine?
The IUPAC name of 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine (CID 84773729) is 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine.
What is the SMILES notation for 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine?
The canonical SMILES for 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine is NC1(c2cc3c(s2)CCOC3)CC1.
What is the InChIKey of 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine?
The InChIKey is MHCKIRLSRZLXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NOS/c11-10(2-3-10)9-5-7-6-12-4-1-8(7)13-9/h5H,1-4,6,11H2.
What are the key properties of 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine?
1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine has a molecular weight of 195.29 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)cyclopropan-1-amine is sourced from PubChem (CID 84773729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).