2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid

C11H13FO2 — CID 84773962

IUPAC2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid
SMILESCc1cc(C)c(CC(=O)O)c(C)c1F
InChIInChI=1S/C11H13FO2/c1-6-4-7(2)11(12)8(3)9(6)5-10(13)14/h4H,5H2,1-3H3,(H,13,14)
InChIKeyLHVCWTAKUWRSIB-UHFFFAOYSA-N
MW196.22 g/mol
LogP2.38
Rot. Bonds2

About 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid

2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid (PubChem CID 84773962) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid
PubChem CID84773962
Molecular FormulaC11H13FO2
Molecular Weight196.22 g/mol
Exact Mass196.09
IUPAC Name2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid
SMILESCc1cc(C)c(CC(=O)O)c(C)c1F
InChIInChI=1S/C11H13FO2/c1-6-4-7(2)11(12)8(3)9(6)5-10(13)14/h4H,5H2,1-3H3,(H,13,14)
InChIKeyLHVCWTAKUWRSIB-UHFFFAOYSA-N
XLogP2.38
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.22
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid?
The IUPAC name of 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid (CID 84773962) is 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid.
What is the SMILES notation for 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid?
The canonical SMILES for 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid is Cc1cc(C)c(CC(=O)O)c(C)c1F.
What is the InChIKey of 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid?
The InChIKey is LHVCWTAKUWRSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2/c1-6-4-7(2)11(12)8(3)9(6)5-10(13)14/h4H,5H2,1-3H3,(H,13,14).
What are the key properties of 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid?
2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid has a molecular weight of 196.22 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-2,4,6-trimethylphenyl)acetic acid is sourced from PubChem (CID 84773962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).