About 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile
1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile (PubChem CID 84774894) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile |
| PubChem CID | 84774894 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2cnc3ccnn3c2)CCC1 |
| InChI | InChI=1S/C11H10N4/c12-8-11(3-1-4-11)9-6-13-10-2-5-14-15(10)7-9/h2,5-7H,1,3-4H2 |
| InChIKey | ULRNSUGDHWKMAI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile?
The IUPAC name of 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile (CID 84774894) is 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile.
What is the SMILES notation for 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile?
The canonical SMILES for 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile is N#CC1(c2cnc3ccnn3c2)CCC1.
What is the InChIKey of 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile?
The InChIKey is ULRNSUGDHWKMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c12-8-11(3-1-4-11)9-6-13-10-2-5-14-15(10)7-9/h2,5-7H,1,3-4H2.
What are the key properties of 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile?
1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile has a molecular weight of 198.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazolo[1,5-a]pyrimidin-6-ylcyclobutane-1-carbonitrile is sourced from PubChem (CID 84774894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).