C7H9F4NO — CID 84775073
1,1,1,4-tetrafluoro-3-isocyanato-4-methylpentane (PubChem CID 84775073) has the molecular formula C7H9F4NO and a molecular weight of 199.15 g/mol. Its IUPAC name is 1,1,1,4-tetrafluoro-3-isocyanato-4-methylpentane.
| Compound Name | 1,1,1,4-tetrafluoro-3-isocyanato-4-methylpentane |
|---|---|
| PubChem CID | 84775073 |
| Molecular Formula | C7H9F4NO |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1,1,1,4-tetrafluoro-3-isocyanato-4-methylpentane |
| SMILES | CC(C)(F)C(CC(F)(F)F)N=C=O |
| InChI | InChI=1S/C7H9F4NO/c1-6(2,8)5(12-4-13)3-7(9,10)11/h5H,3H2,1-2H3 |
| InChIKey | QVGWMJKDNVRXON-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|