About 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol
2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol (PubChem CID 84775410) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol |
| PubChem CID | 84775410 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol |
| SMILES | NC(CO)c1cc2c(s1)CCOC2 |
| InChI | InChI=1S/C9H13NO2S/c10-7(4-11)9-3-6-5-12-2-1-8(6)13-9/h3,7,11H,1-2,4-5,10H2 |
| InChIKey | GIADOZIGKFYTHL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol?
The IUPAC name of 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol (CID 84775410) is 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol.
What is the SMILES notation for 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol?
The canonical SMILES for 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol is NC(CO)c1cc2c(s1)CCOC2.
What is the InChIKey of 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol?
The InChIKey is GIADOZIGKFYTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c10-7(4-11)9-3-6-5-12-2-1-8(6)13-9/h3,7,11H,1-2,4-5,10H2.
What are the key properties of 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol?
2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol has a molecular weight of 199.27 g/mol, XLogP of 0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanol is sourced from PubChem (CID 84775410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).