About 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene
1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene (PubChem CID 84777046) has the molecular formula C9H5F4N
and a molecular weight of 203.14 g/mol. Its IUPAC name is 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene.
Molecular Properties
| Compound Name | 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene |
| PubChem CID | 84777046 |
| Molecular Formula | C9H5F4N |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene |
| SMILES | [C-]#[N+]C(c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C9H5F4N/c1-14-8(9(11,12)13)6-4-2-3-5-7(6)10/h2-5,8H |
| InChIKey | DBJCRVHLFALTPN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene?
The IUPAC name of 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene (CID 84777046) is 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene.
What is the SMILES notation for 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene?
The canonical SMILES for 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene is [C-]#[N+]C(c1ccccc1F)C(F)(F)F.
What is the InChIKey of 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene?
The InChIKey is DBJCRVHLFALTPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F4N/c1-14-8(9(11,12)13)6-4-2-3-5-7(6)10/h2-5,8H.
What are the key properties of 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene?
1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene has a molecular weight of 203.14 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene is sourced from PubChem (CID 84777046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).