C9H5F4N — CID 84777046
1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene (PubChem CID 84777046) has the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. Its IUPAC name is 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene.
| Compound Name | 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene |
|---|---|
| PubChem CID | 84777046 |
| Molecular Formula | C9H5F4N |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1-fluoro-2-(2,2,2-trifluoro-1-isocyanoethyl)benzene |
| SMILES | [C-]#[N+]C(c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C9H5F4N/c1-14-8(9(11,12)13)6-4-2-3-5-7(6)10/h2-5,8H |
| InChIKey | DBJCRVHLFALTPN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|