About 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline
2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline (PubChem CID 84777504) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline.
Molecular Properties
| Compound Name | 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline |
| PubChem CID | 84777504 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline |
| SMILES | CN1C2CC1CN(c1ccccc1N)C2 |
| InChI | InChI=1S/C12H17N3/c1-14-9-6-10(14)8-15(7-9)12-5-3-2-4-11(12)13/h2-5,9-10H,6-8,13H2,1H3 |
| InChIKey | YGAPOPRTOKLJKU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline?
The IUPAC name of 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline (CID 84777504) is 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline.
What is the SMILES notation for 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline?
The canonical SMILES for 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline is CN1C2CC1CN(c1ccccc1N)C2.
What is the InChIKey of 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline?
The InChIKey is YGAPOPRTOKLJKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-14-9-6-10(14)8-15(7-9)12-5-3-2-4-11(12)13/h2-5,9-10H,6-8,13H2,1H3.
What are the key properties of 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline?
2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline has a molecular weight of 203.29 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline is sourced from PubChem (CID 84777504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).