3-butyl-4-fluorooxane-3-carboxylic acid

C10H17FO3 — CID 84777882

IUPAC3-butyl-4-fluorooxane-3-carboxylic acid
SMILESCCCCC1(C(=O)O)COCCC1F
InChIInChI=1S/C10H17FO3/c1-2-3-5-10(9(12)13)7-14-6-4-8(10)11/h8H,2-7H2,1H3,(H,12,13)
InChIKeyGJCMIEKNOVXJFA-UHFFFAOYSA-N
MW204.24 g/mol
LogP2.01
Rot. Bonds4

About 3-butyl-4-fluorooxane-3-carboxylic acid

3-butyl-4-fluorooxane-3-carboxylic acid (PubChem CID 84777882) has the molecular formula C10H17FO3 and a molecular weight of 204.24 g/mol. Its IUPAC name is 3-butyl-4-fluorooxane-3-carboxylic acid.

Molecular Properties

Compound Name3-butyl-4-fluorooxane-3-carboxylic acid
PubChem CID84777882
Molecular FormulaC10H17FO3
Molecular Weight204.24 g/mol
Exact Mass204.12
IUPAC Name3-butyl-4-fluorooxane-3-carboxylic acid
SMILESCCCCC1(C(=O)O)COCCC1F
InChIInChI=1S/C10H17FO3/c1-2-3-5-10(9(12)13)7-14-6-4-8(10)11/h8H,2-7H2,1H3,(H,12,13)
InChIKeyGJCMIEKNOVXJFA-UHFFFAOYSA-N
XLogP2.01
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.24
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-butyl-4-fluorooxane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-Ethyloxane-3-carboxylic acid
CID 63013275
3-[3-(2,2,2-Trifluoroethoxy)propyl]oxane-3-carboxylic acid
CID 55150695
2-Ethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]hexanoic acid
CID 62739221
3-Ethyl-4-fluorooxane-3-carboxylic acid
CID 84767107
4-Fluoro-3-propyloxane-3-carboxylic acid
CID 84771489
Methyl 3-ethyl-4-fluorooxane-3-carboxylate
CID 84771490
3-Ethyl-4,4-difluorooxane-3-carboxylic acid
CID 84773056
3-(Cyclopropylmethyl)-4-fluorooxane-3-carboxylic acid
CID 84776747
4-Fluoro-3-(2-methylpropyl)oxane-3-carboxylic acid
CID 84777881
4,4-Difluoro-3-propyloxane-3-carboxylic acid
CID 84780084
3-(Cyclobutylmethyl)-4-fluorooxane-3-carboxylic acid
CID 84784702
Methyl 3-(cyclopropylmethyl)-4-fluorooxane-3-carboxylate
CID 84784703

Frequently Asked Questions

What is the IUPAC name of 3-butyl-4-fluorooxane-3-carboxylic acid?
The IUPAC name of 3-butyl-4-fluorooxane-3-carboxylic acid (CID 84777882) is 3-butyl-4-fluorooxane-3-carboxylic acid.
What is the SMILES notation for 3-butyl-4-fluorooxane-3-carboxylic acid?
The canonical SMILES for 3-butyl-4-fluorooxane-3-carboxylic acid is CCCCC1(C(=O)O)COCCC1F.
What is the InChIKey of 3-butyl-4-fluorooxane-3-carboxylic acid?
The InChIKey is GJCMIEKNOVXJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FO3/c1-2-3-5-10(9(12)13)7-14-6-4-8(10)11/h8H,2-7H2,1H3,(H,12,13).
What are the key properties of 3-butyl-4-fluorooxane-3-carboxylic acid?
3-butyl-4-fluorooxane-3-carboxylic acid has a molecular weight of 204.24 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-fluorooxane-3-carboxylic acid is sourced from PubChem (CID 84777882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).