C11H12FN3 — CID 84778426
1-cyclobutyl-7-fluorobenzimidazol-2-amine (PubChem CID 84778426) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 1-cyclobutyl-7-fluorobenzimidazol-2-amine.
| Compound Name | 1-cyclobutyl-7-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 84778426 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-cyclobutyl-7-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2cccc(F)c2n1C1CCC1 |
| InChI | InChI=1S/C11H12FN3/c12-8-5-2-6-9-10(8)15(11(13)14-9)7-3-1-4-7/h2,5-7H,1,3-4H2,(H2,13,14) |
| InChIKey | SOUGVTSZPIFBSJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |