About 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol
2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol (PubChem CID 84779151) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol |
| PubChem CID | 84779151 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol |
| SMILES | NC1(c2nc3ccc(O)cc3s2)CC1 |
| InChI | InChI=1S/C10H10N2OS/c11-10(3-4-10)9-12-7-2-1-6(13)5-8(7)14-9/h1-2,5,13H,3-4,11H2 |
| InChIKey | GFFRLTPMZMNFEJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol?
The IUPAC name of 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol (CID 84779151) is 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol is NC1(c2nc3ccc(O)cc3s2)CC1.
What is the InChIKey of 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol?
The InChIKey is GFFRLTPMZMNFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c11-10(3-4-10)9-12-7-2-1-6(13)5-8(7)14-9/h1-2,5,13H,3-4,11H2.
What are the key properties of 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol?
2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol has a molecular weight of 206.27 g/mol, XLogP of 1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminocyclopropyl)-1,3-benzothiazol-6-ol is sourced from PubChem (CID 84779151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).