C12H16FNO — CID 84780671
2-(4-fluoro-3,5-dimethylphenyl)morpholine (PubChem CID 84780671) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-(4-fluoro-3,5-dimethylphenyl)morpholine.
| Compound Name | 2-(4-fluoro-3,5-dimethylphenyl)morpholine |
|---|---|
| PubChem CID | 84780671 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(4-fluoro-3,5-dimethylphenyl)morpholine |
| SMILES | Cc1cc(C2CNCCO2)cc(C)c1F |
| InChI | InChI=1S/C12H16FNO/c1-8-5-10(6-9(2)12(8)13)11-7-14-3-4-15-11/h5-6,11,14H,3-4,7H2,1-2H3 |
| InChIKey | VOSLPEHSYNHUNH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |