C7H11FO4S — CID 84781151
4-fluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid (PubChem CID 84781151) has the molecular formula C7H11FO4S and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-fluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 4-fluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 84781151 |
| Molecular Formula | C7H11FO4S |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-fluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CS(=O)(=O)CCC1F |
| InChI | InChI=1S/C7H11FO4S/c1-7(6(9)10)4-13(11,12)3-2-5(7)8/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | QCWWWBSGKZHXIO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |