About 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal
3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal (PubChem CID 84781306) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal.
Molecular Properties
| Compound Name | 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal |
| PubChem CID | 84781306 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal |
| SMILES | O=CCCN1CCCN(C2CCC2)C1=O |
| InChI | InChI=1S/C11H18N2O2/c14-9-3-7-12-6-2-8-13(11(12)15)10-4-1-5-10/h9-10H,1-8H2 |
| InChIKey | AWHYOZVGXZXQRF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal?
The IUPAC name of 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal (CID 84781306) is 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal.
What is the SMILES notation for 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal?
The canonical SMILES for 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal is O=CCCN1CCCN(C2CCC2)C1=O.
What is the InChIKey of 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal?
The InChIKey is AWHYOZVGXZXQRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c14-9-3-7-12-6-2-8-13(11(12)15)10-4-1-5-10/h9-10H,1-8H2.
What are the key properties of 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal?
3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal has a molecular weight of 210.28 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyclobutyl-2-oxo-1,3-diazinan-1-yl)propanal is sourced from PubChem (CID 84781306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).