C11H14ClNO — CID 84782027
2-(1-aminocyclopropyl)-6-chloro-3,5-dimethylphenol (PubChem CID 84782027) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 2-(1-aminocyclopropyl)-6-chloro-3,5-dimethylphenol.
| Compound Name | 2-(1-aminocyclopropyl)-6-chloro-3,5-dimethylphenol |
|---|---|
| PubChem CID | 84782027 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(1-aminocyclopropyl)-6-chloro-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(C2(N)CC2)c(O)c1Cl |
| InChI | InChI=1S/C11H14ClNO/c1-6-5-7(2)9(12)10(14)8(6)11(13)3-4-11/h5,14H,3-4,13H2,1-2H3 |
| InChIKey | BSHMMJYLLVCBMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|