About 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile
3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile (PubChem CID 84782323) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile |
| PubChem CID | 84782323 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile |
| SMILES | N#CCCc1ncnn1Cc1ccccc1 |
| InChI | InChI=1S/C12H12N4/c13-8-4-7-12-14-10-15-16(12)9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7,9H2 |
| InChIKey | GXZFWOIKPYPCFL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile?
The IUPAC name of 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile (CID 84782323) is 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile.
What is the SMILES notation for 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile?
The canonical SMILES for 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile is N#CCCc1ncnn1Cc1ccccc1.
What is the InChIKey of 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile?
The InChIKey is GXZFWOIKPYPCFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c13-8-4-7-12-14-10-15-16(12)9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7,9H2.
What are the key properties of 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile?
3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile has a molecular weight of 212.26 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-benzyl-1,2,4-triazol-3-yl)propanenitrile is sourced from PubChem (CID 84782323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).