About (3-bromo-2,4-dimethylphenyl)methanamine
(3-bromo-2,4-dimethylphenyl)methanamine (PubChem CID 84783317) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is (3-bromo-2,4-dimethylphenyl)methanamine.
Molecular Properties
| Compound Name | (3-bromo-2,4-dimethylphenyl)methanamine |
| PubChem CID | 84783317 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | (3-bromo-2,4-dimethylphenyl)methanamine |
| SMILES | Cc1ccc(CN)c(C)c1Br |
| InChI | InChI=1S/C9H12BrN/c1-6-3-4-8(5-11)7(2)9(6)10/h3-4H,5,11H2,1-2H3 |
| InChIKey | JKUNMJKEMGABAM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-bromo-2,4-dimethylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,4-dimethylphenyl)methanamine?
The IUPAC name of (3-bromo-2,4-dimethylphenyl)methanamine (CID 84783317) is (3-bromo-2,4-dimethylphenyl)methanamine.
What is the SMILES notation for (3-bromo-2,4-dimethylphenyl)methanamine?
The canonical SMILES for (3-bromo-2,4-dimethylphenyl)methanamine is Cc1ccc(CN)c(C)c1Br.
What is the InChIKey of (3-bromo-2,4-dimethylphenyl)methanamine?
The InChIKey is JKUNMJKEMGABAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-6-3-4-8(5-11)7(2)9(6)10/h3-4H,5,11H2,1-2H3.
What are the key properties of (3-bromo-2,4-dimethylphenyl)methanamine?
(3-bromo-2,4-dimethylphenyl)methanamine has a molecular weight of 214.11 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,4-dimethylphenyl)methanamine is sourced from PubChem (CID 84783317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).