C10H11ClO3 — CID 84783600
2-(3-chloro-4-hydroxy-5-methylphenyl)propanoic acid (PubChem CID 84783600) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxy-5-methylphenyl)propanoic acid.
| Compound Name | 2-(3-chloro-4-hydroxy-5-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 84783600 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-(3-chloro-4-hydroxy-5-methylphenyl)propanoic acid |
| SMILES | Cc1cc(C(C)C(=O)O)cc(Cl)c1O |
| InChI | InChI=1S/C10H11ClO3/c1-5-3-7(6(2)10(13)14)4-8(11)9(5)12/h3-4,6,12H,1-2H3,(H,13,14) |
| InChIKey | OENJBBPBKBXTBH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |