C11H15F2NO — CID 84783908
3-[4-(2,2-difluoroethoxy)phenyl]propan-1-amine (PubChem CID 84783908) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 3-[4-(2,2-difluoroethoxy)phenyl]propan-1-amine.
| Compound Name | 3-[4-(2,2-difluoroethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 84783908 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[4-(2,2-difluoroethoxy)phenyl]propan-1-amine |
| SMILES | NCCCc1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C11H15F2NO/c12-11(13)8-15-10-5-3-9(4-6-10)2-1-7-14/h3-6,11H,1-2,7-8,14H2 |
| InChIKey | FDIBYWRCCABBDV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |