C15H15N5O2S — CID 847847
N-ethyl-4-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 847847) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is N-ethyl-4-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | N-ethyl-4-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 847847 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-ethyl-4-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(-c2ccc(-n3cnnn3)cc2)cc1 |
| InChI | InChI=1S/C15H15N5O2S/c1-2-17-23(21,22)15-9-5-13(6-10-15)12-3-7-14(8-4-12)20-11-16-18-19-20/h3-11,17H,2H2,1H3 |
| InChIKey | CZUBFGSDUMZUPK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |