About 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine
1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine (PubChem CID 84786009) has the molecular formula C11H11FN4
and a molecular weight of 218.24 g/mol. Its IUPAC name is 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine |
| PubChem CID | 84786009 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine |
| SMILES | NC1(c2ccc(-n3cncn3)c(F)c2)CC1 |
| InChI | InChI=1S/C11H11FN4/c12-9-5-8(11(13)3-4-11)1-2-10(9)16-7-14-6-15-16/h1-2,5-7H,3-4,13H2 |
| InChIKey | FXKMXAIIODBDCI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine?
The IUPAC name of 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine (CID 84786009) is 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine?
The canonical SMILES for 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine is NC1(c2ccc(-n3cncn3)c(F)c2)CC1.
What is the InChIKey of 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine?
The InChIKey is FXKMXAIIODBDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4/c12-9-5-8(11(13)3-4-11)1-2-10(9)16-7-14-6-15-16/h1-2,5-7H,3-4,13H2.
What are the key properties of 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine?
1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine has a molecular weight of 218.24 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]cyclopropan-1-amine is sourced from PubChem (CID 84786009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).