About 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol
4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol (PubChem CID 84786229) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol |
| PubChem CID | 84786229 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol |
| SMILES | CN1CC2CC1CN2Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-14-8-12-6-11(14)9-15(12)7-10-2-4-13(16)5-3-10/h2-5,11-12,16H,6-9H2,1H3 |
| InChIKey | YTXUOEYRGZKMAP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol?
The IUPAC name of 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol (CID 84786229) is 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol.
What is the SMILES notation for 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol?
The canonical SMILES for 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol is CN1CC2CC1CN2Cc1ccc(O)cc1.
What is the InChIKey of 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol?
The InChIKey is YTXUOEYRGZKMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-14-8-12-6-11(14)9-15(12)7-10-2-4-13(16)5-3-10/h2-5,11-12,16H,6-9H2,1H3.
What are the key properties of 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol?
4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol has a molecular weight of 218.30 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methyl]phenol is sourced from PubChem (CID 84786229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).