About 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol
3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol (PubChem CID 84788053) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol |
| PubChem CID | 84788053 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol |
| SMILES | Cc1cc(C(N)CCO)cc2c1OC(C)C2 |
| InChI | InChI=1S/C13H19NO2/c1-8-5-10(12(14)3-4-15)7-11-6-9(2)16-13(8)11/h5,7,9,12,15H,3-4,6,14H2,1-2H3 |
| InChIKey | HLKIYWYHFKZWRG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol?
The IUPAC name of 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol (CID 84788053) is 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol.
What is the SMILES notation for 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol?
The canonical SMILES for 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol is Cc1cc(C(N)CCO)cc2c1OC(C)C2.
What is the InChIKey of 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol?
The InChIKey is HLKIYWYHFKZWRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-8-5-10(12(14)3-4-15)7-11-6-9(2)16-13(8)11/h5,7,9,12,15H,3-4,6,14H2,1-2H3.
What are the key properties of 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol?
3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol has a molecular weight of 221.30 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-ol is sourced from PubChem (CID 84788053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).