About 3-butyl-4,4-difluorooxane-3-carboxylic acid
3-butyl-4,4-difluorooxane-3-carboxylic acid (PubChem CID 84788528) has the molecular formula C10H16F2O3
and a molecular weight of 222.23 g/mol. Its IUPAC name is 3-butyl-4,4-difluorooxane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-butyl-4,4-difluorooxane-3-carboxylic acid |
| PubChem CID | 84788528 |
| Molecular Formula | C10H16F2O3 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-butyl-4,4-difluorooxane-3-carboxylic acid |
| SMILES | CCCCC1(C(=O)O)COCCC1(F)F |
| InChI | InChI=1S/C10H16F2O3/c1-2-3-4-9(8(13)14)7-15-6-5-10(9,11)12/h2-7H2,1H3,(H,13,14) |
| InChIKey | UFGGMWPUYUUOIW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-4,4-difluorooxane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4,4-difluorooxane-3-carboxylic acid?
The IUPAC name of 3-butyl-4,4-difluorooxane-3-carboxylic acid (CID 84788528) is 3-butyl-4,4-difluorooxane-3-carboxylic acid.
What is the SMILES notation for 3-butyl-4,4-difluorooxane-3-carboxylic acid?
The canonical SMILES for 3-butyl-4,4-difluorooxane-3-carboxylic acid is CCCCC1(C(=O)O)COCCC1(F)F.
What is the InChIKey of 3-butyl-4,4-difluorooxane-3-carboxylic acid?
The InChIKey is UFGGMWPUYUUOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O3/c1-2-3-4-9(8(13)14)7-15-6-5-10(9,11)12/h2-7H2,1H3,(H,13,14).
What are the key properties of 3-butyl-4,4-difluorooxane-3-carboxylic acid?
3-butyl-4,4-difluorooxane-3-carboxylic acid has a molecular weight of 222.23 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4,4-difluorooxane-3-carboxylic acid is sourced from PubChem (CID 84788528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).