2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid

C7H14N2O4S — CID 84788623

IUPAC2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid
SMILESCC(C(=O)O)N1CCCN(C)S1(=O)=O
InChIInChI=1S/C7H14N2O4S/c1-6(7(10)11)9-5-3-4-8(2)14(9,12)13/h6H,3-5H2,1-2H3,(H,10,11)
InChIKeySFNQVRIKGVRXLQ-UHFFFAOYSA-N
MW222.27 g/mol
LogP-0.66
Rot. Bonds2

About 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid

2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid (PubChem CID 84788623) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid.

Molecular Properties

Compound Name2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid
PubChem CID84788623
Molecular FormulaC7H14N2O4S
Molecular Weight222.27 g/mol
Exact Mass222.07
IUPAC Name2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid
SMILESCC(C(=O)O)N1CCCN(C)S1(=O)=O
InChIInChI=1S/C7H14N2O4S/c1-6(7(10)11)9-5-3-4-8(2)14(9,12)13/h6H,3-5H2,1-2H3,(H,10,11)
InChIKeySFNQVRIKGVRXLQ-UHFFFAOYSA-N
XLogP-0.66
TPSA77.92 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.27
LogP ≤ 5-0.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid?
The IUPAC name of 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid (CID 84788623) is 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid.
What is the SMILES notation for 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid?
The canonical SMILES for 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid is CC(C(=O)O)N1CCCN(C)S1(=O)=O.
What is the InChIKey of 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid?
The InChIKey is SFNQVRIKGVRXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O4S/c1-6(7(10)11)9-5-3-4-8(2)14(9,12)13/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid?
2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid has a molecular weight of 222.27 g/mol, XLogP of -0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)propanoic acid is sourced from PubChem (CID 84788623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).