C13H18FNO — CID 84789117
3-[(4-fluoro-2-methoxyphenyl)methyl]piperidine (PubChem CID 84789117) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 3-[(4-fluoro-2-methoxyphenyl)methyl]piperidine.
| Compound Name | 3-[(4-fluoro-2-methoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 84789117 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[(4-fluoro-2-methoxyphenyl)methyl]piperidine |
| SMILES | COc1cc(F)ccc1CC1CCCNC1 |
| InChI | InChI=1S/C13H18FNO/c1-16-13-8-12(14)5-4-11(13)7-10-3-2-6-15-9-10/h4-5,8,10,15H,2-3,6-7,9H2,1H3 |
| InChIKey | MDHQKZAYSFYDQU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |