methyl 4-ethyl-3,3-difluorothiane-4-carboxylate

C9H14F2O2S — CID 84789718

IUPACmethyl 4-ethyl-3,3-difluorothiane-4-carboxylate
SMILESCCC1(C(=O)OC)CCSCC1(F)F
InChIInChI=1S/C9H14F2O2S/c1-3-8(7(12)13-2)4-5-14-6-9(8,10)11/h3-6H2,1-2H3
InChIKeyQSWMJPTWRFGWIG-UHFFFAOYSA-N
MW224.27 g/mol
LogP2.33
Rot. Bonds2

About methyl 4-ethyl-3,3-difluorothiane-4-carboxylate

methyl 4-ethyl-3,3-difluorothiane-4-carboxylate (PubChem CID 84789718) has the molecular formula C9H14F2O2S and a molecular weight of 224.27 g/mol. Its IUPAC name is methyl 4-ethyl-3,3-difluorothiane-4-carboxylate.

Molecular Properties

Compound Namemethyl 4-ethyl-3,3-difluorothiane-4-carboxylate
PubChem CID84789718
Molecular FormulaC9H14F2O2S
Molecular Weight224.27 g/mol
Exact Mass224.07
IUPAC Namemethyl 4-ethyl-3,3-difluorothiane-4-carboxylate
SMILESCCC1(C(=O)OC)CCSCC1(F)F
InChIInChI=1S/C9H14F2O2S/c1-3-8(7(12)13-2)4-5-14-6-9(8,10)11/h3-6H2,1-2H3
InChIKeyQSWMJPTWRFGWIG-UHFFFAOYSA-N
XLogP2.33
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.27
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-ethyl-3,3-difluorothiane-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-ethyl-3,3-difluorothiane-4-carboxylate?
The IUPAC name of methyl 4-ethyl-3,3-difluorothiane-4-carboxylate (CID 84789718) is methyl 4-ethyl-3,3-difluorothiane-4-carboxylate.
What is the SMILES notation for methyl 4-ethyl-3,3-difluorothiane-4-carboxylate?
The canonical SMILES for methyl 4-ethyl-3,3-difluorothiane-4-carboxylate is CCC1(C(=O)OC)CCSCC1(F)F.
What is the InChIKey of methyl 4-ethyl-3,3-difluorothiane-4-carboxylate?
The InChIKey is QSWMJPTWRFGWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2S/c1-3-8(7(12)13-2)4-5-14-6-9(8,10)11/h3-6H2,1-2H3.
What are the key properties of methyl 4-ethyl-3,3-difluorothiane-4-carboxylate?
methyl 4-ethyl-3,3-difluorothiane-4-carboxylate has a molecular weight of 224.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethyl-3,3-difluorothiane-4-carboxylate is sourced from PubChem (CID 84789718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).