About 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one
3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 84789780) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
Molecular Properties
| Compound Name | 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| PubChem CID | 84789780 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1OC2(CCCNCC2)CN1C1CCC1 |
| InChI | InChI=1S/C12H20N2O2/c15-11-14(10-3-1-4-10)9-12(16-11)5-2-7-13-8-6-12/h10,13H,1-9H2 |
| InChIKey | MXPPOXYJFMWUBC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one?
The IUPAC name of 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (CID 84789780) is 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
What is the SMILES notation for 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one?
The canonical SMILES for 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one is O=C1OC2(CCCNCC2)CN1C1CCC1.
What is the InChIKey of 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one?
The InChIKey is MXPPOXYJFMWUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c15-11-14(10-3-1-4-10)9-12(16-11)5-2-7-13-8-6-12/h10,13H,1-9H2.
What are the key properties of 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one?
3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one has a molecular weight of 224.30 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one is sourced from PubChem (CID 84789780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).