About 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole
5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole (PubChem CID 84792298) has the molecular formula C11H17FN2S
and a molecular weight of 228.34 g/mol. Its IUPAC name is 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole |
| PubChem CID | 84792298 |
| Molecular Formula | C11H17FN2S |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole |
| SMILES | CC(C)(F)c1cnc(C2CCCNC2)s1 |
| InChI | InChI=1S/C11H17FN2S/c1-11(2,12)9-7-14-10(15-9)8-4-3-5-13-6-8/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | VFWYNBZHKKCGOZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole?
The IUPAC name of 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole (CID 84792298) is 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole.
What is the SMILES notation for 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole?
The canonical SMILES for 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole is CC(C)(F)c1cnc(C2CCCNC2)s1.
What is the InChIKey of 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole?
The InChIKey is VFWYNBZHKKCGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2S/c1-11(2,12)9-7-14-10(15-9)8-4-3-5-13-6-8/h7-8,13H,3-6H2,1-2H3.
What are the key properties of 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole?
5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole has a molecular weight of 228.34 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoropropan-2-yl)-2-piperidin-3-yl-1,3-thiazole is sourced from PubChem (CID 84792298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).