C11H16FNO3 — CID 84792671
2-fluoro-4-[1-hydroxy-2-(methylamino)ethyl]-3-methoxy-6-methylphenol (PubChem CID 84792671) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is 2-fluoro-4-[1-hydroxy-2-(methylamino)ethyl]-3-methoxy-6-methylphenol.
| Compound Name | 2-fluoro-4-[1-hydroxy-2-(methylamino)ethyl]-3-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 84792671 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-fluoro-4-[1-hydroxy-2-(methylamino)ethyl]-3-methoxy-6-methylphenol |
| SMILES | CNCC(O)c1cc(C)c(O)c(F)c1OC |
| InChI | InChI=1S/C11H16FNO3/c1-6-4-7(8(14)5-13-2)11(16-3)9(12)10(6)15/h4,8,13-15H,5H2,1-3H3 |
| InChIKey | BWIIPZZHQICHKL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |