C12H12N2O3 — CID 84795284
4-(2-oxo-3,6-diazabicyclo[3.1.1]heptan-3-yl)benzoic acid (PubChem CID 84795284) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-(2-oxo-3,6-diazabicyclo[3.1.1]heptan-3-yl)benzoic acid.
| Compound Name | 4-(2-oxo-3,6-diazabicyclo[3.1.1]heptan-3-yl)benzoic acid |
|---|---|
| PubChem CID | 84795284 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-(2-oxo-3,6-diazabicyclo[3.1.1]heptan-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CC3CC(N3)C2=O)cc1 |
| InChI | InChI=1S/C12H12N2O3/c15-11-10-5-8(13-10)6-14(11)9-3-1-7(2-4-9)12(16)17/h1-4,8,10,13H,5-6H2,(H,16,17) |
| InChIKey | PNXAPGANLCXTFX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |