3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid

C13H16N2O2 — CID 84795452

IUPAC3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1(N2CCc3ccccc32)CCNC1
InChIInChI=1S/C13H16N2O2/c16-12(17)13(6-7-14-9-13)15-8-5-10-3-1-2-4-11(10)15/h1-4,14H,5-9H2,(H,16,17)
InChIKeyWHQGSQDUZRUONV-UHFFFAOYSA-N
MW232.28 g/mol
LogP0.87
Rot. Bonds2

About 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid

3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid (PubChem CID 84795452) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid
PubChem CID84795452
Molecular FormulaC13H16N2O2
Molecular Weight232.28 g/mol
Exact Mass232.12
IUPAC Name3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1(N2CCc3ccccc32)CCNC1
InChIInChI=1S/C13H16N2O2/c16-12(17)13(6-7-14-9-13)15-8-5-10-3-1-2-4-11(10)15/h1-4,14H,5-9H2,(H,16,17)
InChIKeyWHQGSQDUZRUONV-UHFFFAOYSA-N
XLogP0.87
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid (CID 84795452) is 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid is O=C(O)C1(N2CCc3ccccc32)CCNC1.
What is the InChIKey of 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid?
The InChIKey is WHQGSQDUZRUONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c16-12(17)13(6-7-14-9-13)15-8-5-10-3-1-2-4-11(10)15/h1-4,14H,5-9H2,(H,16,17).
What are the key properties of 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid?
3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid has a molecular weight of 232.28 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroindol-1-yl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 84795452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).