C13H20N4 — CID 84795626
(6-cycloheptyl-5H-imidazo[1,2-b]pyrazol-2-yl)methanamine (PubChem CID 84795626) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (6-cycloheptyl-5H-imidazo[1,2-b]pyrazol-2-yl)methanamine.
| Compound Name | (6-cycloheptyl-5H-imidazo[1,2-b]pyrazol-2-yl)methanamine |
|---|---|
| PubChem CID | 84795626 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (6-cycloheptyl-5H-imidazo[1,2-b]pyrazol-2-yl)methanamine |
| SMILES | NCc1cn2[nH]c(C3CCCCCC3)cc2n1 |
| InChI | InChI=1S/C13H20N4/c14-8-11-9-17-13(15-11)7-12(16-17)10-5-3-1-2-4-6-10/h7,9-10,16H,1-6,8,14H2 |
| InChIKey | VFBCDARMEXFFMC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |