C13H18N2O2 — CID 84797001
3-[(3,5-dimethyl-4-nitrophenyl)methyl]pyrrolidine (PubChem CID 84797001) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitrophenyl)methyl]pyrrolidine.
| Compound Name | 3-[(3,5-dimethyl-4-nitrophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 84797001 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitrophenyl)methyl]pyrrolidine |
| SMILES | Cc1cc(CC2CCNC2)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O2/c1-9-5-12(7-11-3-4-14-8-11)6-10(2)13(9)15(16)17/h5-6,11,14H,3-4,7-8H2,1-2H3 |
| InChIKey | FYOALTCXOIHUHL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|