About 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid
3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid (PubChem CID 84797310) has the molecular formula C9H11F2NO2S
and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid |
| PubChem CID | 84797310 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid |
| SMILES | CC(Cc1cnc(C(C)(F)F)s1)C(=O)O |
| InChI | InChI=1S/C9H11F2NO2S/c1-5(7(13)14)3-6-4-12-8(15-6)9(2,10)11/h4-5H,3H2,1-2H3,(H,13,14) |
| InChIKey | DBLVZSIXDJFTQW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid?
The IUPAC name of 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid (CID 84797310) is 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid?
The canonical SMILES for 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid is CC(Cc1cnc(C(C)(F)F)s1)C(=O)O.
What is the InChIKey of 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid?
The InChIKey is DBLVZSIXDJFTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO2S/c1-5(7(13)14)3-6-4-12-8(15-6)9(2,10)11/h4-5H,3H2,1-2H3,(H,13,14).
What are the key properties of 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid?
3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid has a molecular weight of 235.25 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-2-methylpropanoic acid is sourced from PubChem (CID 84797310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).