C13H16O4 — CID 84798070
2-[1-(5-ethyl-2,4-dihydroxyphenyl)cyclopropyl]acetic acid (PubChem CID 84798070) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[1-(5-ethyl-2,4-dihydroxyphenyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(5-ethyl-2,4-dihydroxyphenyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 84798070 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[1-(5-ethyl-2,4-dihydroxyphenyl)cyclopropyl]acetic acid |
| SMILES | CCc1cc(C2(CC(=O)O)CC2)c(O)cc1O |
| InChI | InChI=1S/C13H16O4/c1-2-8-5-9(11(15)6-10(8)14)13(3-4-13)7-12(16)17/h5-6,14-15H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | KMXJHUZDETUSOU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |