About 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one
7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one (PubChem CID 84798191) has the molecular formula C13H17FN2O
and a molecular weight of 236.29 g/mol. Its IUPAC name is 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one |
| PubChem CID | 84798191 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one |
| SMILES | Cc1ccc(C2CC(=O)NCCN2)c(C)c1F |
| InChI | InChI=1S/C13H17FN2O/c1-8-3-4-10(9(2)13(8)14)11-7-12(17)16-6-5-15-11/h3-4,11,15H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | VKBBKQPYHDGMEA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one?
The IUPAC name of 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one (CID 84798191) is 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one.
What is the SMILES notation for 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one?
The canonical SMILES for 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one is Cc1ccc(C2CC(=O)NCCN2)c(C)c1F.
What is the InChIKey of 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one?
The InChIKey is VKBBKQPYHDGMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2O/c1-8-3-4-10(9(2)13(8)14)11-7-12(17)16-6-5-15-11/h3-4,11,15H,5-7H2,1-2H3,(H,16,17).
What are the key properties of 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one?
7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one has a molecular weight of 236.29 g/mol, XLogP of 1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-fluoro-2,4-dimethylphenyl)-1,4-diazepan-5-one is sourced from PubChem (CID 84798191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).