C13H18FNO2 — CID 84799616
3-[(2-fluoro-3,6-dimethoxyphenyl)methyl]pyrrolidine (PubChem CID 84799616) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 3-[(2-fluoro-3,6-dimethoxyphenyl)methyl]pyrrolidine.
| Compound Name | 3-[(2-fluoro-3,6-dimethoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 84799616 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-[(2-fluoro-3,6-dimethoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1ccc(OC)c(CC2CCNC2)c1F |
| InChI | InChI=1S/C13H18FNO2/c1-16-11-3-4-12(17-2)13(14)10(11)7-9-5-6-15-8-9/h3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | XCMFICGNWCWWAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |