About 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride
3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride (PubChem CID 84800602) has the molecular formula C7H6ClFO4S
and a molecular weight of 240.64 g/mol. Its IUPAC name is 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride.
Analyze 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride?
The IUPAC name of 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride (CID 84800602) is 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride.
What is the SMILES notation for 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride?
The canonical SMILES for 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride is Cc1cc(S(=O)(=O)Cl)c(O)c(F)c1O.
What is the InChIKey of 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride?
The InChIKey is NVAMJGIFLYXIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClFO4S/c1-3-2-4(14(8,12)13)7(11)5(9)6(3)10/h2,10-11H,1H3.
What are the key properties of 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride?
3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride has a molecular weight of 240.64 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4-dihydroxy-5-methylbenzenesulfonyl chloride is sourced from PubChem (CID 84800602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).