About 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine
3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine (PubChem CID 84801306) has the molecular formula C13H17ClFN
and a molecular weight of 241.74 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine |
| PubChem CID | 84801306 |
| Molecular Formula | C13H17ClFN |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine |
| SMILES | Cc1cc(Cl)c(C)c(CC2CCNC2)c1F |
| InChI | InChI=1S/C13H17ClFN/c1-8-5-12(14)9(2)11(13(8)15)6-10-3-4-16-7-10/h5,10,16H,3-4,6-7H2,1-2H3 |
| InChIKey | FNUXYRDDCHGKGY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine?
The IUPAC name of 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine (CID 84801306) is 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine.
What is the SMILES notation for 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine?
The canonical SMILES for 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine is Cc1cc(Cl)c(C)c(CC2CCNC2)c1F.
What is the InChIKey of 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine?
The InChIKey is FNUXYRDDCHGKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClFN/c1-8-5-12(14)9(2)11(13(8)15)6-10-3-4-16-7-10/h5,10,16H,3-4,6-7H2,1-2H3.
What are the key properties of 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine?
3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine has a molecular weight of 241.74 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2-fluoro-3,6-dimethylphenyl)methyl]pyrrolidine is sourced from PubChem (CID 84801306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).