About 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine
2-(4-bromo-2,3-dimethylphenyl)propan-2-amine (PubChem CID 84801575) has the molecular formula C11H16BrN
and a molecular weight of 242.16 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine.
Molecular Properties
| Compound Name | 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine |
| PubChem CID | 84801575 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine |
| SMILES | Cc1c(Br)ccc(C(C)(C)N)c1C |
| InChI | InChI=1S/C11H16BrN/c1-7-8(2)10(12)6-5-9(7)11(3,4)13/h5-6H,13H2,1-4H3 |
| InChIKey | QQBYMNMABBCPEE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine?
The IUPAC name of 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine (CID 84801575) is 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine.
What is the SMILES notation for 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine?
The canonical SMILES for 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine is Cc1c(Br)ccc(C(C)(C)N)c1C.
What is the InChIKey of 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine?
The InChIKey is QQBYMNMABBCPEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN/c1-7-8(2)10(12)6-5-9(7)11(3,4)13/h5-6H,13H2,1-4H3.
What are the key properties of 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine?
2-(4-bromo-2,3-dimethylphenyl)propan-2-amine has a molecular weight of 242.16 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2,3-dimethylphenyl)propan-2-amine is sourced from PubChem (CID 84801575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).