C11H13ClFNO2 — CID 84802916
1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)cyclopropan-1-amine (PubChem CID 84802916) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)cyclopropan-1-amine.
| Compound Name | 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84802916 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)cyclopropan-1-amine |
| SMILES | COc1c(F)cc(C2(N)CC2)c(OC)c1Cl |
| InChI | InChI=1S/C11H13ClFNO2/c1-15-9-6(11(14)3-4-11)5-7(13)10(16-2)8(9)12/h5H,3-4,14H2,1-2H3 |
| InChIKey | BZRGAOBUXJPFLC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |