C11H16F2O2S — CID 84803914
4-(cyclobutylmethyl)-3,3-difluorothiane-4-carboxylic acid (PubChem CID 84803914) has the molecular formula C11H16F2O2S and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-3,3-difluorothiane-4-carboxylic acid.
| Compound Name | 4-(cyclobutylmethyl)-3,3-difluorothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 84803914 |
| Molecular Formula | C11H16F2O2S |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(cyclobutylmethyl)-3,3-difluorothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(CC2CCC2)CCSCC1(F)F |
| InChI | InChI=1S/C11H16F2O2S/c12-11(13)7-16-5-4-10(11,9(14)15)6-8-2-1-3-8/h8H,1-7H2,(H,14,15) |
| InChIKey | FCMGQFFGLVPHCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |