About 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde
4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde (PubChem CID 84804065) has the molecular formula C12H13NO3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde |
| PubChem CID | 84804065 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CC3CC2CS3(=O)=O)cc1 |
| InChI | InChI=1S/C12H13NO3S/c14-7-9-1-3-10(4-2-9)13-6-12-5-11(13)8-17(12,15)16/h1-4,7,11-12H,5-6,8H2 |
| InChIKey | DPOHZDCGTSPLHN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde?
The IUPAC name of 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde (CID 84804065) is 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde.
What is the SMILES notation for 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde?
The canonical SMILES for 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde is O=Cc1ccc(N2CC3CC2CS3(=O)=O)cc1.
What is the InChIKey of 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde?
The InChIKey is DPOHZDCGTSPLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3S/c14-7-9-1-3-10(4-2-9)13-6-12-5-11(13)8-17(12,15)16/h1-4,7,11-12H,5-6,8H2.
What are the key properties of 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde?
4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde has a molecular weight of 251.31 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)benzaldehyde is sourced from PubChem (CID 84804065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).