C11H18F2O2S — CID 84804268
methyl 4-butyl-3,3-difluorothiane-4-carboxylate (PubChem CID 84804268) has the molecular formula C11H18F2O2S and a molecular weight of 252.33 g/mol. Its IUPAC name is methyl 4-butyl-3,3-difluorothiane-4-carboxylate.
| Compound Name | methyl 4-butyl-3,3-difluorothiane-4-carboxylate |
|---|---|
| PubChem CID | 84804268 |
| Molecular Formula | C11H18F2O2S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl 4-butyl-3,3-difluorothiane-4-carboxylate |
| SMILES | CCCCC1(C(=O)OC)CCSCC1(F)F |
| InChI | InChI=1S/C11H18F2O2S/c1-3-4-5-10(9(14)15-2)6-7-16-8-11(10,12)13/h3-8H2,1-2H3 |
| InChIKey | LGGGPHOXQMQPLE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |