About 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine
2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine (PubChem CID 84804497) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine |
| PubChem CID | 84804497 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine |
| SMILES | CC(CN)c1cccc(C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-10(8-14)11-3-2-4-12(7-11)13-5-6-17(15,16)9-13/h2-4,7,10,13H,5-6,8-9,14H2,1H3 |
| InChIKey | GHXWOYNXPSMOGN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine?
The IUPAC name of 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine (CID 84804497) is 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine.
What is the SMILES notation for 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine?
The canonical SMILES for 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine is CC(CN)c1cccc(C2CCS(=O)(=O)C2)c1.
What is the InChIKey of 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine?
The InChIKey is GHXWOYNXPSMOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-10(8-14)11-3-2-4-12(7-11)13-5-6-17(15,16)9-13/h2-4,7,10,13H,5-6,8-9,14H2,1H3.
What are the key properties of 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine?
2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine has a molecular weight of 253.37 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,1-dioxothiolan-3-yl)phenyl]propan-1-amine is sourced from PubChem (CID 84804497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).