C12H18BrN — CID 84805272
3-(2-bromo-4,6-dimethylphenyl)butan-1-amine (PubChem CID 84805272) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is 3-(2-bromo-4,6-dimethylphenyl)butan-1-amine.
| Compound Name | 3-(2-bromo-4,6-dimethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 84805272 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-(2-bromo-4,6-dimethylphenyl)butan-1-amine |
| SMILES | Cc1cc(C)c(C(C)CCN)c(Br)c1 |
| InChI | InChI=1S/C12H18BrN/c1-8-6-10(3)12(11(13)7-8)9(2)4-5-14/h6-7,9H,4-5,14H2,1-3H3 |
| InChIKey | IFNSRMBDXDYKEP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |